Calusterone
Chemical compound
Calusterone![]() | |
Trade names | Methosarb, Riedemil |
---|
Other names | 7β,17α-Dimethyltestosterone; NSC-88536; U-22550 |
---|
Routes of administration | By mouth |
---|
|
(7S,8R,9S,10R,13S,14S,17S)-17-hydroxy-7,10,13,17-tetramethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one
| CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C21H32O2 |
---|
Molar mass | 316.485 g·mol−1 |
---|
3D model (JSmol) | |
---|
O=C4\C=C3/[C@]([C@H]2CC[C@]1([C@@H](CC[C@@]1(O)C)[C@@H]2[C@@H](C)C3)C)(C)CC4
|
InChI=1S/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16-,17-,18+,19-,20-,21-/m0/s1 Key:IVFYLRMMHVYGJH-PVPPCFLZSA-N
|
Calusterone (INN, USAN) (brand names Methosarb, Riedemil; former developmental code names NSC-88536, U-22550), also known as 7β,17α-dimethyltestosterone, is an orally active anabolic-androgenic steroid (AAS) that is used as an antineoplastic agent.[1][2] It is a 17α-alkylated AAS similar in structure to bolasterone (which is its 7α-isomer).[1]
Calusterone is on the World Anti-Doping Agency's list of prohibited substances,[3] and is therefore banned from use in most major sports.
References
|
---|
Androgens (incl. AASTooltip anabolic–androgenic steroid) | |
---|
Antiandrogens | ARTooltip Androgen receptor antagonists | |
---|
Steroidogenesis inhibitors | |
---|
Antigonadotropins |
- D2 receptor antagonists (prolactin releasers) (e.g., domperidone, metoclopramide, risperidone, haloperidol, chlorpromazine, sulpiride)
- Estrogens (e.g., bifluranol, diethylstilbestrol, estradiol, estradiol esters, ethinylestradiol, ethinylestradiol sulfonate, paroxypropione)
- GnRH agonists (e.g., leuprorelin)
- GnRH antagonists (e.g., cetrorelix)
- Progestogens (incl., chlormadinone acetate, cyproterone acetate, hydroxyprogesterone caproate, gestonorone caproate, medroxyprogesterone acetate, megestrol acetate)
|
---|
Others | |
---|
|
---|
|
|
---|
ARTooltip Androgen receptor | Agonists | |
---|
SARMsTooltip Selective androgen receptor modulator | |
---|
Antagonists | |
---|
|
---|
GPRC6A | |
---|
|
|
|